Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
MilliporeSigma™ D-Mannose-6-phosphate, Disodium Salt, Calbiochem™,
CAS: 33068-18-7 Molecular Formula: C6H13Na2O9P Molecular Weight (g/mol): 306.114 InChI Key: UUYHWNKAOZTLOW-OXIHULNRSA-N PubChem CID: 131852496 IUPAC Name: sodium;[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate SMILES: C(C(C(C(C(C=O)O)O)O)O)OP(=O)(O)O.[Na].[Na]
| PubChem CID | 131852496 |
|---|---|
| CAS | 33068-18-7 |
| Molecular Weight (g/mol) | 306.114 |
| SMILES | C(C(C(C(C(C=O)O)O)O)O)OP(=O)(O)O.[Na].[Na] |
| IUPAC Name | sodium;[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate |
| InChI Key | UUYHWNKAOZTLOW-OXIHULNRSA-N |
| Molecular Formula | C6H13Na2O9P |
| MDL Number | MFCD00144065 |
|---|
Iron(III) 2,4-pentanedionate
CAS: 14024-18-1 Molecular Formula: C15H21FeO6 Molecular Weight (g/mol): 353.17 MDL Number: MFCD00000020 InChI Key: AQBLLJNPHDIAPN-LNTINUHCSA-K Synonym: Iron(III) acetylacetonate; Tris(acetylacetonato)iron(III) IUPAC Name: iron(3+) tris((2Z)-4-oxopent-2-en-2-olate) SMILES: [Fe+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| CAS | 14024-18-1 |
|---|---|
| Molecular Weight (g/mol) | 353.17 |
| MDL Number | MFCD00000020 |
| SMILES | [Fe+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | Iron(III) acetylacetonate; Tris(acetylacetonato)iron(III) |
| IUPAC Name | iron(3+) tris((2Z)-4-oxopent-2-en-2-olate) |
| InChI Key | AQBLLJNPHDIAPN-LNTINUHCSA-K |
| Molecular Formula | C15H21FeO6 |
MilliporeSigma™ MTT, Calbiochem™,
CAS: 298-93-1 Molecular Formula: C18H16BrN5S Molecular Weight (g/mol): 414.33 MDL Number: MFCD00011964,MFCD00066662 InChI Key: AZKSAVLVSZKNRD-UHFFFAOYSA-M Synonym: thiazolyl blue,thiazolyl blue tetrazolium bromide,mmt tetrazolium,methylthiazoletetrazolium,mtt,thiazolyl blue monotetrazolium,thiazole blue,3-4,5-dimethylthiazol-2-yl-2,5-diphenyltetrazolium bromide,mtt van,unii-euy85h477i PubChem CID: 64965 ChEBI: CHEBI:53233 IUPAC Name: 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3,5-diphenyl-3H-1,2λ⁵,3,4-tetrazol-2-ylium bromide SMILES: [Br-].CC1=C(C)N=C(S1)[N+]1=NC(=NN1C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 64965 |
|---|---|
| CAS | 298-93-1 |
| Molecular Weight (g/mol) | 414.33 |
| ChEBI | CHEBI:53233 |
| MDL Number | MFCD00011964,MFCD00066662 |
| SMILES | [Br-].CC1=C(C)N=C(S1)[N+]1=NC(=NN1C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | thiazolyl blue,thiazolyl blue tetrazolium bromide,mmt tetrazolium,methylthiazoletetrazolium,mtt,thiazolyl blue monotetrazolium,thiazole blue,3-4,5-dimethylthiazol-2-yl-2,5-diphenyltetrazolium bromide,mtt van,unii-euy85h477i |
| IUPAC Name | 2-(4,5-dimethyl-1,3-thiazol-2-yl)-3,5-diphenyl-3H-1,2λ⁵,3,4-tetrazol-2-ylium bromide |
| InChI Key | AZKSAVLVSZKNRD-UHFFFAOYSA-M |
| Molecular Formula | C18H16BrN5S |
Tetra-n-butylammonium sulfate, 50% w/w aq. soln.
CAS: 2472-88-0 Molecular Formula: C32H72N2O4S Molecular Weight (g/mol): 581.00 MDL Number: MFCD00216632 InChI Key: ZXUCBXRTRRIBSO-UHFFFAOYSA-L Synonym: bis tetrabutylammonium sulphate,tetrabutylammonium sulfate,tetrabutylammonium sulfate solution,1-butanaminium, n,n,n-tributyl-, sulfate 2:1,tetrabutyl ammoniumsulfat,tetrabutylammonium sulphate,acmc-1cdo3,tetrabutyl ammonium sulfate,tetrabutyl-ammonium sulfate,tetra-n-butylammonium sulfate PubChem CID: 11433187 IUPAC Name: tetrabutylazanium;sulfate SMILES: [O-]S([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 11433187 |
|---|---|
| CAS | 2472-88-0 |
| Molecular Weight (g/mol) | 581.00 |
| MDL Number | MFCD00216632 |
| SMILES | [O-]S([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | bis tetrabutylammonium sulphate,tetrabutylammonium sulfate,tetrabutylammonium sulfate solution,1-butanaminium, n,n,n-tributyl-, sulfate 2:1,tetrabutyl ammoniumsulfat,tetrabutylammonium sulphate,acmc-1cdo3,tetrabutyl ammonium sulfate,tetrabutyl-ammonium sulfate,tetra-n-butylammonium sulfate |
| IUPAC Name | tetrabutylazanium;sulfate |
| InChI Key | ZXUCBXRTRRIBSO-UHFFFAOYSA-L |
| Molecular Formula | C32H72N2O4S |
Zinc acrylate
CAS: 14643-87-9 Molecular Formula: C6H6O4Zn Molecular Weight (g/mol): 207.49 MDL Number: MFCD00067208 InChI Key: XKMZOFXGLBYJLS-UHFFFAOYSA-L Synonym: zinc acrylate,zinc diacrylate,2-propenoic acid, zinc salt,acrylic acid, zinc salt,2-propenoic acid, zinc salt 2:1,zinc prop-2-enoate,79-10-7 parent,acmc-20aj8t,dsstox_cid_7768,dsstox_rid_78559 PubChem CID: 159747 IUPAC Name: zinc;prop-2-enoate SMILES: [Zn++].[O-]C(=O)C=C.[O-]C(=O)C=C
| PubChem CID | 159747 |
|---|---|
| CAS | 14643-87-9 |
| Molecular Weight (g/mol) | 207.49 |
| MDL Number | MFCD00067208 |
| SMILES | [Zn++].[O-]C(=O)C=C.[O-]C(=O)C=C |
| Synonym | zinc acrylate,zinc diacrylate,2-propenoic acid, zinc salt,acrylic acid, zinc salt,2-propenoic acid, zinc salt 2:1,zinc prop-2-enoate,79-10-7 parent,acmc-20aj8t,dsstox_cid_7768,dsstox_rid_78559 |
| IUPAC Name | zinc;prop-2-enoate |
| InChI Key | XKMZOFXGLBYJLS-UHFFFAOYSA-L |
| Molecular Formula | C6H6O4Zn |
Tris(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionato)erbium(III), 97+%, Thermo Scientific™
CAS: 17978-75-5 Molecular Formula: C30H33ErF21O6 Molecular Weight (g/mol): 1055.81 MDL Number: MFCD00074990 InChI Key: LEHFMLQRGJCLOZ-UHFFFAOYSA-N Synonym: resolve-al? erfod
| CAS | 17978-75-5 |
|---|---|
| Molecular Weight (g/mol) | 1055.81 |
| MDL Number | MFCD00074990 |
| Synonym | resolve-al? erfod |
| InChI Key | LEHFMLQRGJCLOZ-UHFFFAOYSA-N |
| Molecular Formula | C30H33ErF21O6 |
2,6-Dimethyl-3,5-heptanedione, 97+%
CAS: 18362-64-6 Molecular Formula: C9H16O2 Molecular Weight (g/mol): 156.225 MDL Number: MFCD00015040 InChI Key: CEGGECULKVTYMM-UHFFFAOYSA-N Synonym: 2,6-dimethyl-3,5-heptanedione,diisobutyrylmethane,3,5-heptanedione, 2,6-dimethyl,acmc-209ekw,2,6-dimethyl-3,5-heptandione PubChem CID: 87597 IUPAC Name: 2,6-dimethylheptane-3,5-dione SMILES: CC(C)C(=O)CC(=O)C(C)C
| PubChem CID | 87597 |
|---|---|
| CAS | 18362-64-6 |
| Molecular Weight (g/mol) | 156.225 |
| MDL Number | MFCD00015040 |
| SMILES | CC(C)C(=O)CC(=O)C(C)C |
| Synonym | 2,6-dimethyl-3,5-heptanedione,diisobutyrylmethane,3,5-heptanedione, 2,6-dimethyl,acmc-209ekw,2,6-dimethyl-3,5-heptandione |
| IUPAC Name | 2,6-dimethylheptane-3,5-dione |
| InChI Key | CEGGECULKVTYMM-UHFFFAOYSA-N |
| Molecular Formula | C9H16O2 |
Fullerene powder, 99.9+% C{60}
CAS: 99685-96-8 Molecular Formula: C60 Molecular Weight (g/mol): 720.66 MDL Number: MFCD00282904 InChI Key: XMWRBQBLMFGWIX-UHFFFAOYSA-N Synonym: fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih PubChem CID: 123591 ChEBI: CHEBI:33128 IUPAC Name: (C\{60}-I\{h})[5,6]fullerene SMILES: C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41
| PubChem CID | 123591 |
|---|---|
| CAS | 99685-96-8 |
| Molecular Weight (g/mol) | 720.66 |
| ChEBI | CHEBI:33128 |
| MDL Number | MFCD00282904 |
| SMILES | C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41 |
| Synonym | fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih |
| IUPAC Name | (C\{60}-I\{h})[5,6]fullerene |
| InChI Key | XMWRBQBLMFGWIX-UHFFFAOYSA-N |
| Molecular Formula | C60 |
2-Hydroxyacetophenone, 97+%
CAS: 582-24-1 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00041829 InChI Key: ZWVHTXAYIKBMEE-UHFFFAOYSA-N Synonym: 2-hydroxyacetophenone,benzoylcarbinol,glycolophenone,phenacyl alcohol,alpha-hydroxyacetophenone,2-hydroxy-1-phenylethan-1-one,ethanone, 2-hydroxy-1-phenyl,methanol, benzoyl,omega-hydroxyacetophenone,acetophenone, 2-hydroxy PubChem CID: 68490 ChEBI: CHEBI:28341 IUPAC Name: 2-hydroxy-1-phenylethanone SMILES: C1=CC=C(C=C1)C(=O)CO
| PubChem CID | 68490 |
|---|---|
| CAS | 582-24-1 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:28341 |
| MDL Number | MFCD00041829 |
| SMILES | C1=CC=C(C=C1)C(=O)CO |
| Synonym | 2-hydroxyacetophenone,benzoylcarbinol,glycolophenone,phenacyl alcohol,alpha-hydroxyacetophenone,2-hydroxy-1-phenylethan-1-one,ethanone, 2-hydroxy-1-phenyl,methanol, benzoyl,omega-hydroxyacetophenone,acetophenone, 2-hydroxy |
| IUPAC Name | 2-hydroxy-1-phenylethanone |
| InChI Key | ZWVHTXAYIKBMEE-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
1,5-Cyclooctadiene(pyridine)(tricyclohexylphosphine)iridium(I) hexafluorophosphate, 99%
CAS: 64536-78-3 Molecular Formula: C31H50F6IrNP2 Molecular Weight (g/mol): 804.90 MDL Number: MFCD00075097 InChI Key: UJXHUUQZACSUOG-KJWGIZLLSA-N Synonym: crabtree's catalyst,unii-816rs2nbpn,816rs2nbpn,1,5-cyclooctadiene pyridine tricyclohexylphosphine iridium hexafluorophosphate,iridium i hexafluorophosphate,1,5-cyclooctadiene pyridine tricyclohexylphosphine iridium i hexafluorophosphate,tricyclohexylphosphine 1,5-cyclooctadiene pyridine iridium i hexafluorophosphate,felkin-crabtree catalyst,crabtree's catalyst mi,crabtree's catalyst hexafluorophosphate PubChem CID: 5702647 IUPAC Name: (1Z,5Z)-cycloocta-1,5-diene;iridium;pyridine;tricyclohexylphosphane;hexafluorophosphate SMILES: [Ir+].C1=CC=NC=C1.F[P-](F)(F)(F)(F)F.C1C\C=C/CC\C=C/1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1
| PubChem CID | 5702647 |
|---|---|
| CAS | 64536-78-3 |
| Molecular Weight (g/mol) | 804.90 |
| MDL Number | MFCD00075097 |
| SMILES | [Ir+].C1=CC=NC=C1.F[P-](F)(F)(F)(F)F.C1C\C=C/CC\C=C/1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1 |
| Synonym | crabtree's catalyst,unii-816rs2nbpn,816rs2nbpn,1,5-cyclooctadiene pyridine tricyclohexylphosphine iridium hexafluorophosphate,iridium i hexafluorophosphate,1,5-cyclooctadiene pyridine tricyclohexylphosphine iridium i hexafluorophosphate,tricyclohexylphosphine 1,5-cyclooctadiene pyridine iridium i hexafluorophosphate,felkin-crabtree catalyst,crabtree's catalyst mi,crabtree's catalyst hexafluorophosphate |
| IUPAC Name | (1Z,5Z)-cycloocta-1,5-diene;iridium;pyridine;tricyclohexylphosphane;hexafluorophosphate |
| InChI Key | UJXHUUQZACSUOG-KJWGIZLLSA-N |
| Molecular Formula | C31H50F6IrNP2 |
| MDL Number | MFCD00133992 |
|---|
| MDL Number | MFCD00133992 |
|---|
Diethylene glycol dibutyl ether, 99+%
CAS: 112-73-2 Molecular Formula: C12H26O3 Molecular Weight (g/mol): 218.337 MDL Number: MFCD00009459 InChI Key: KZVBBTZJMSWGTK-UHFFFAOYSA-N Synonym: diethylene glycol dibutyl ether,bis 2-butoxyethyl ether,dibutyl carbitol,butyl diglyme,1-2-2-butoxyethoxy ethoxy butane,5,8,11-trioxapentadecane,ether, bis butoxyethyl,2,2'-dibutoxyethyl ether,ether, bis 2-butoxyethyl PubChem CID: 8210 IUPAC Name: 1-[2-(2-butoxyethoxy)ethoxy]butane SMILES: CCCCOCCOCCOCCCC
| PubChem CID | 8210 |
|---|---|
| CAS | 112-73-2 |
| Molecular Weight (g/mol) | 218.337 |
| MDL Number | MFCD00009459 |
| SMILES | CCCCOCCOCCOCCCC |
| Synonym | diethylene glycol dibutyl ether,bis 2-butoxyethyl ether,dibutyl carbitol,butyl diglyme,1-2-2-butoxyethoxy ethoxy butane,5,8,11-trioxapentadecane,ether, bis butoxyethyl,2,2'-dibutoxyethyl ether,ether, bis 2-butoxyethyl |
| IUPAC Name | 1-[2-(2-butoxyethoxy)ethoxy]butane |
| InChI Key | KZVBBTZJMSWGTK-UHFFFAOYSA-N |
| Molecular Formula | C12H26O3 |
Dibromobis(triphenylphosphine)nickel(II), 99%, Thermo Scientific Chemicals
CAS: 14126-37-5 Molecular Formula: C36H30Br2NiP2 Molecular Weight (g/mol): 743.09 MDL Number: MFCD00015865 InChI Key: QEKXARSPUFVXIX-UHFFFAOYSA-L Synonym: nickel ii bromide bis triphenylphosphine,nibr2 pph3 2,dibromobis triphenylphosphine nickel ii,bis triphenylphosphine nickel ii bromide,dibromobis triphenylphosphine nickel,dibromonickel; bis triphenylphosphine,bis triphenylphosphine dibromonickel ii PubChem CID: 11050914 IUPAC Name: dibromonickel;triphenylphosphane SMILES: Br[Ni]Br.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11050914 |
|---|---|
| CAS | 14126-37-5 |
| Molecular Weight (g/mol) | 743.09 |
| MDL Number | MFCD00015865 |
| SMILES | Br[Ni]Br.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | nickel ii bromide bis triphenylphosphine,nibr2 pph3 2,dibromobis triphenylphosphine nickel ii,bis triphenylphosphine nickel ii bromide,dibromobis triphenylphosphine nickel,dibromonickel; bis triphenylphosphine,bis triphenylphosphine dibromonickel ii |
| IUPAC Name | dibromonickel;triphenylphosphane |
| InChI Key | QEKXARSPUFVXIX-UHFFFAOYSA-L |
| Molecular Formula | C36H30Br2NiP2 |